PRODUCT Properties
| Melting point: | 170-172°C |
| Boiling point: | 379.79°C (rough estimate) |
| Density | 1.1469 (rough estimate) |
| vapor pressure | 0-0Pa at 20-50℃ |
| refractive index | 1.5500 (estimate) |
| storage temp. | room temp |
| pka | 2.27±0.20(Predicted) |
| form | Powder |
| color | Orange to Brown |
| Water Solubility | 73.55ug/L(25 ºC) |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C15H11NO2/c1-16-12-8-4-7-11-13(12)15(18)10-6-3-2-5-9(10)14(11)17/h2-8,16H,1H3 |
| InChIKey | SVTDYSXXLJYUTM-UHFFFAOYSA-N |
| SMILES | CNc1cccc2C(=O)c3ccccc3C(=O)c12 |
| LogP | 4.95 at 23℃ and pH8.2 |
| CAS DataBase Reference | 82-38-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-(N-Methylamino)-9,10-anthraquinone(82-38-2) |
| EPA Substance Registry System | C.I. Disperse Red 9 (82-38-2) |
Description and Uses
1-Methylaminoanthraquinone is an important intermediate for manufacturing solvent dyes and acid dyes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | CB0536600 |
| TSCA | TSCA listed |
| HS Code | 2922.39.4500 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



