BD2582445
2-Aminoadamantane-2-carboxylicacid , 95% , 42381-05-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB276.00 | In Stock |
|
| 250mg | RMB417.60 | In Stock |
|
| 1g | RMB1341.60 | In Stock |
|
| 5g | RMB5527.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 346.2±25.0 °C(Predicted) |
| Density | 1.238±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 2.49±0.20(Predicted) |
| form | Solid |
| color | Off-white to brown |
| InChI | InChI=1S/C11H17NO2/c12-11(10(13)14)8-2-6-1-7(4-8)5-9(11)3-6/h6-9H,1-5,12H2,(H,13,14) |
| InChIKey | WQMQRNCPZFUGID-UHFFFAOYSA-N |
| SMILES | C12CC3CC(CC(C3)C1(N)C(O)=O)C2 |
Description and Uses
Adamantanine is a γ-turn inducer for peptides. A potential cholecystokinin-B (CCK-B) receptor selective ligands. Also, it inhibits the transport of L-leucine and L-methionine into Ehrlich ascites cells.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 2922498590 |
