BD2651648
Sodium3-methyl-2-oxopentanoate , 95% , 3715-31-9
Synonym(s):
(±)-Sodium 3-methyl-2-oxovalerate;DL -α-Keto-β-methylvaleric acid sodium salt;2-Keto-3-methylvaleric acid sodium salt;3-Methyl-2-oxopentanoic acid sodium salt;Ketoisoleucine sodium salt
CAS NO.：3715-31-9
Empirical Formula: C6H9NaO3
Molecular Weight: 152.12
MDL number: MFCD00002584
EINECS: 223-063-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB190.40 | In Stock |
|
| 5g | RMB576.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 204-206 °C(lit.) |
| storage temp. | 2-8°C |
| solubility | Methanol (Slightly), Water (Sparingly, Sonicated) |
| form | Solid |
| color | White to Off-White |
| Odor | very mild fruity |
| BRN | 7779663 |
| InChI | 1S/C6H10O3.Na/c1-3-4(2)5(7)6(8)9;/h4H,3H2,1-2H3,(H,8,9);/q;+1/p-1 |
| InChIKey | SMDJDLCNOXJGKC-UHFFFAOYSA-M |
| SMILES | [Na+].CCC(C)C(=O)C([O-])=O |
| LogP | 0.17 |
Description and Uses
3-Methyl-2-oxopentanoic acid sodium salt may be used in chemical synthesis studies.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |
