BD2673645
7-Chloro-4-hydroxyquinoline-3-carboxylicacid , 95% , 86-47-5
CAS NO.:86-47-5
Empirical Formula: C10H6ClNO3
Molecular Weight: 223.61
MDL number: MFCD00038080
EINECS: 201-673-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB143.20 | In Stock |
|
| 250mg | RMB263.20 | In Stock |
|
| 1g | RMB728.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 250 °C (dec.)(lit.) |
| Boiling point: | 416.5±45.0 °C(Predicted) |
| Density | 1.600 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 0.65±0.30(Predicted) |
| color | White to Pale Brown |
| InChI | 1S/C10H6ClNO3/c11-5-1-2-6-8(3-5)12-4-7(9(6)13)10(14)15/h1-4H,(H,12,13)(H,14,15) |
| InChIKey | SACLIBNEKWTDEG-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cnc2cc(Cl)ccc2c1O |
| CAS DataBase Reference | 86-47-5(CAS DataBase Reference) |
Description and Uses
7-CHLORO-4-HYDROXY QUINOLINE-3-CARBOXYLIC ACID is used as a pharmaceutical and dye intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | VB1950000 |
| HS Code | 2933499090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






![5-[Ethyl(2-hydroxyethyl)amino]-2-pentanone](https://img.chemicalbook.com/CAS/GIF/74509-79-8.gif)