BD2725445
8-Boc-2,4,8-triazaspiro[4.5]decane-1,3-dione , 98% , 183673-70-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB140.00 | In Stock |
|
| 5g | RMB500.00 | In Stock |
|
| 10g | RMB849.60 | In Stock |
|
| 25g | RMB1699.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 242-244°C |
| Density | 1.28±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Dichloromethane, DMSO, Methanol |
| form | Solid |
| pka | 10.10±0.20(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C12H19N3O4/c1-11(2,3)19-10(18)15-6-4-12(5-7-15)8(16)13-9(17)14-12/h4-7H2,1-3H3,(H2,13,14,16,17) |
| InChIKey | DHJXKTPWDXJQEK-UHFFFAOYSA-N |
| SMILES | N1C2(CCN(C(OC(C)(C)C)=O)CC2)C(=O)NC1=O |
| CAS DataBase Reference | 183673-70-3 |
Description and Uses
A cyclic α,α-disubstituted amino acid for preparation of water-soluble highly helical peptides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P337+P313-P305+P351+P338-P302+P352-P332+P313-P362 |
| HS Code | 2933599590 |

![8-Boc-2,4,8-triazaspiro[4.5]decane-1,3-dione](https://img.chemicalbook.com/StructureFile/ChemBookStructure6/GIF/CB0337964.gif)
