PRODUCT Properties
| Melting point: | 232-233 °C(lit.) |
| solubility | Soluble in acetone and benzene. |
| form | Crystalline Powder |
| color | White |
| Sensitive | Hygroscopic |
| InChI | 1S/4C2H4O2.Sn/c4*1-2(3)4;/h4*1H3,(H,3,4);/q;;;;+4/p-4 |
| InChIKey | YJGJRYWNNHUESM-UHFFFAOYSA-J |
| SMILES | CC(=O)O[Sn](OC(C)=O)(OC(C)=O)OC(C)=O |
| CAS DataBase Reference | 2800-96-6(CAS DataBase Reference) |
Description and Uses
Tin(IV) acetate is used to prepare tin-based oxides (Sn-Zn-P-O), which is a negative electrodes for rechargeable lithium batteries.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| RIDADR | UN 3146 6.1/PG 3 |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 29152900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
