BD2730945
Fmoc-Cys(Dpm)-OH , 97% , 247595-29-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB28.80 | In Stock |
|
| 5g | RMB60.80 | In Stock |
|
| 10g | RMB117.60 | In Stock |
|
| 25g | RMB227.20 | In Stock |
|
| 100g | RMB773.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 714.3±60.0 °C(Predicted) |
| Density | 1.281±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| form | powder |
| pka | 3.43±0.10(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | Consistent with structure |
| Major Application | peptide synthesis |
| InChIKey | IVPLDYIPIHKRET-NDEPHWFRSA-N |
| SMILES | S(C[C@H](NC(=O)OCC3c4c(cccc4)c5c3cccc5)C(=O)O)C(c2ccccc2)c1ccccc1 |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| WGK Germany | WGK 1 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |