BD2733245
Bis(4-(tert-butyl)phenyl)iodoniumtrifluoromethanesulfonate , 98% , 84563-54-2
Synonym(s):
Bis(4-tert-butylphenyl)iodonium trifluoromethanesulfonate;DtBPIT
CAS NO.:84563-54-2
Empirical Formula: C21H26F3IO3S
Molecular Weight: 542.39
MDL number: MFCD02683471
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB62.40 | In Stock |
|
| 250mg | RMB109.60 | In Stock |
|
| 1g | RMB272.80 | In Stock |
|
| 5g | RMB955.20 | In Stock |
|
| 25g | RMB3343.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 237 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | ethyl lactate: ~25% |
| Appearance | Light yellow to light brown Solid |
| InChI | InChI=1S/C20H26I.CHF3O3S/c1-19(2,3)15-7-11-17(12-8-15)21-18-13-9-16(10-14-18)20(4,5)6;2-1(3,4)8(5,6)7/h7-14H,1-6H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | VGZKCAUAQHHGDK-UHFFFAOYSA-M |
| SMILES | C1(C(C)(C)C)C=CC([I+]C2=CC=C(C(C)(C)C)C=C2)=CC=1.C(F)(F)(F)S([O-])(=O)=O |
| CAS DataBase Reference | 84563-54-2 |
Description and Uses
Bis(4-tert-butylphenyl)iodonium triflate is used as a cationic photoinitiator. Photoacid generator.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 36/37/39-26 |
| RIDADR | 3261 |
| WGK Germany | 3 |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |



