BD2743148
2-Iodo-3-methylpyridine , 98% , 22282-58-2
Synonym(s):
2-Iodo-3-picoline
CAS NO.:22282-58-2
Empirical Formula: C6H6IN
Molecular Weight: 219.02
MDL number: MFCD04039350
EINECS: 678-851-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB160.80 | In Stock |
|
| 5g | RMB547.20 | In Stock |
|
| 25g | RMB1733.60 | In Stock |
|
| 100g | RMB5495.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 80°C/0.3mm |
| Density | 1.827 g/mL at 25 °C |
| refractive index | 1.625 |
| Flash point: | >110℃ |
| storage temp. | 2-8°C |
| pka | 2.14±0.10(Predicted) |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| Sensitive | Light Sensitive |
| BRN | 5328169 |
| InChI | InChI=1S/C6H6IN/c1-5-3-2-4-8-6(5)7/h2-4H,1H3 |
| InChIKey | PTBOOHAPESUXGV-UHFFFAOYSA-N |
| SMILES | C1(I)=NC=CC=C1C |
| CAS DataBase Reference | 22282-58-2(CAS DataBase Reference) |
Description and Uses
2-Iodo-3-methylpyridine is a heterocyclic organic compound and can be used as an intermediate in pharmaceutical synthesis.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335-H301-H319 |
| Precautionary statements | P280a-P301+P310a-P405-P501a-P261-P280-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38-41-37/38-22 |
| Safety Statements | 26-36/37/39-39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |








