BD2746845
4-(2-Hydroxyethyl)benzonitrile , 98% , 69395-13-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB46.40 | In Stock |
|
| 1g | RMB147.20 | In Stock |
|
| 5g | RMB497.60 | In Stock |
|
| 10g | RMB910.40 | In Stock |
|
| 25g | RMB1844.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 50-51°C |
| Boiling point: | 118 °C |
| Density | 1.12 |
| Flash point: | 116-118°C/0.5mm |
| storage temp. | Sealed in dry,Room Temperature |
| form | Powder/Chunks |
| pka | 14.72±0.10(Predicted) |
| Appearance | Light yellow to brown Solid |
| InChI | InChI=1S/C9H9NO/c10-7-9-3-1-8(2-4-9)5-6-11/h1-4,11H,5-6H2 |
| InChIKey | RBSJBNYPTGMZIH-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(CCO)C=C1 |
| CAS DataBase Reference | 69395-13-7(CAS DataBase Reference) |
Description and Uses
4-(2-Hydroxyethyl)benzonitrile is used to produce 4-(2-bromo-ethyl)-benzonitrile. It is used as organic intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38-22 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 3439 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2926907090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







