BD2755048
(1R,2S,5R)-2-Isopropyl-5-methylcyclohexylcarbonochloridate , 97% , 14602-86-9
Synonym(s):
(−)-Menthyl chloroformate
CAS NO.:14602-86-9
Empirical Formula: C11H19ClO2
Molecular Weight: 218.72
MDL number: MFCD00009694
EINECS: 672-624-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB64.80 | In Stock |
|
| 5g | RMB237.60 | In Stock |
|
| 25g | RMB860.80 | In Stock |
|
| 100g | RMB2586.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 108-109 °C11 mm Hg(lit.) |
| Density | 1.031 g/mL at 20 °C(lit.) |
| vapor pressure | 0.01 psi ( 20 °C) |
| refractive index | n |
| Flash point: | 158 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Sparingly) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| optical activity | [α]20/D 83°, c = 1 in chloroform |
| Sensitive | Moisture Sensitive |
| BRN | 2414686 |
| InChI | InChI=1S/C11H19ClO2/c1-7(2)9-5-4-8(3)6-10(9)14-11(12)13/h7-10H,4-6H2,1-3H3/t8-,9+,10-/m1/s1 |
| InChIKey | KIUPCUCGVCGPPA-KXUCPTDWSA-N |
| SMILES | C(Cl)(O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)=O |
| CAS DataBase Reference | 14602-86-9(CAS DataBase Reference) |
Description and Uses
Readily forms a chloroimidodicarbonate which asymmetrically chlorinates silyl enol ethers under mild conditions and in good yields.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H314-H331 |
| Precautionary statements | P280-P301+P330+P331-P303+P361+P353-P304+P340+P311-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | T,N |
| Risk Statements | 23-34-51/53 |
| Safety Statements | 26-36/37/39-45-61 |
| RIDADR | UN 3277 6.1/PG 2 |
| WGK Germany | 3 |
| F | 10-19-21 |
| HS Code | 2915.90.5010 |
| HazardClass | 6.1 |
| PackingGroup | II |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Inhalation Skin Corr. 1B |







