BD2765745
PrimaquineDiphosphate , 98% , 63-45-6
Synonym(s):
8-(4-Amino-1-methylbutylamino)-6-methoxyquinoline diphosphate salt;Primaquine bisphosphate;Primaquine diphosphate salt
CAS NO.:63-45-6
Empirical Formula: C15H27N3O9P2
Molecular Weight: 455.34
MDL number: MFCD00013166
EINECS: 200-560-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.80 | In Stock |
|
| 5g | RMB76.00 | In Stock |
|
| 25g | RMB164.80 | In Stock |
|
| 100g | RMB646.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 205-206 °C (dec.)(lit.) |
| storage temp. | 2-8°C |
| solubility | water: soluble50mg/mL, clear, orange to red |
| form | Solid |
| color | Red brown to orange |
| Water Solubility | moderately soluble |
| Merck | 13,7833 |
| BRN | 3812133 |
| BCS Class | 1 (CLogP), 3
(LogP) |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C15H21N3O.2H3O4P/c1-11(5-3-7-16)18-14-10-13(19-2)9-12-6-4-8-17-15(12)14;2*1-5(2,3)4/h4,6,8-11,18H,3,5,7,16H2,1-2H3;2*(H3,1,2,3,4) |
| InChIKey | GJOHLWZHWQUKAU-UHFFFAOYSA-N |
| SMILES | C1(NC(C)CCCN)=CC(=CC2=CC=CN=C12)OC.P(=O)(O)(O)O.P(=O)(O)(O)O |
| CAS DataBase Reference | 63-45-6(CAS DataBase Reference) |
Description and Uses
acetylcholinesterase inhibitor
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301-H341-H361fd |
| Precautionary statements | P201-P202-P264-P270-P280-P301+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | VA9660000 |
| F | 10 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29334900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Muta. 2 Repr. 2 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




