BD2769445
3,4,5-Trichlorothiophene-2-carboxylicacid , 95% , 26020-48-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB700.80 | In Stock |
|
| 250mg | RMB1051.20 | In Stock |
|
| 1g | RMB1855.20 | In Stock |
|
| 5g | RMB4723.20 | In Stock |
|
| 250g | RMB27200.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 226-228°C |
| Boiling point: | 335.6±37.0 °C(Predicted) |
| Density | 1.818±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 2.89±0.10(Predicted) |
| Appearance | Light yellow to light brown Solid |
| Water Solubility | Insoluble in water. |
| BRN | 155175 |
| InChI | InChI=1S/C5HCl3O2S/c6-1-2(7)4(8)11-3(1)5(9)10/h(H,9,10) |
| InChIKey | FVFYTPFJDMYLJS-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)SC(Cl)=C(Cl)C=1Cl |
| CAS DataBase Reference | 26020-48-4 |
Description and Uses
3,4,5-Trichloro-2-thiophenecarboxylic Acid is a useful research chemical compound used as a reactant in the stereoselective synthesis of alkenyl or allylic arenes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
