BD2771445
4-(Benzyloxy)-3-hydroxybenzaldehyde , 97% , 4049-39-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB133.60 | In Stock |
|
| 250mg | RMB236.00 | In Stock |
|
| 1g | RMB619.20 | In Stock |
|
| 5g | RMB1895.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120 °C(Solv: ethanol (64-17-5)) |
| Boiling point: | 403.3±30.0 °C(Predicted) |
| Density | 1.238±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 8.79±0.35(Predicted) |
| color | Off-White to Light Brown |
| InChI | InChI=1S/C14H12O3/c15-9-12-6-7-14(13(16)8-12)17-10-11-4-2-1-3-5-11/h1-9,16H,10H2 |
| InChIKey | HUNGEAFDVLSPAM-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(OCC2=CC=CC=C2)C(O)=C1 |
| CAS DataBase Reference | 4049-39-2 |
Description and Uses
4-Benzyloxy-3-hydroxybenzaldehyde is useful for preparing quinazoline derivatives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P261-P280-P305+P351+P338-P304+P340 |
