BD2775445
tert-Butyl5-bromoindoline-1-carboxylate , 97% , 261732-38-1
Synonym(s):
tert-Butyl 5-bromo-2,3-dihydro-1H-indole-1-carboxylate;5-Bromo-1-(tert-butyloxycarbonyl)-2,3-dihydro-1H-indole;5-Bromo-2,3-dihydro-1H-indole-1-carboxylic acid 1,1-dimethylethyl ester;5-Bromo-2,3-dihydroindole-1-carboxylic acid tert-butyl ester
CAS NO.:261732-38-1
Empirical Formula: C13H16BrNO2
Molecular Weight: 298.18
MDL number: MFCD08059280
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB35.20 | In Stock |
|
| 250mg | RMB44.80 | In Stock |
|
| 1g | RMB124.00 | In Stock |
|
| 5g | RMB507.20 | In Stock |
|
| 10g | RMB980.80 | In Stock |
|
| 25g | RMB2297.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126-128°C |
| Boiling point: | 363℃ |
| Density | 1.400 |
| Flash point: | 173℃ |
| storage temp. | 2-8°C |
| form | Solid |
| pka | -0.02±0.20(Predicted) |
| color | White |
| InChI | 1S/C13H16BrNO2/c1-13(2,3)17-12(16)15-7-6-9-8-10(14)4-5-11(9)15/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | UOCVSZYBRMGQOL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCc2cc(Br)ccc12 |
| CAS DataBase Reference | 261732-38-1 |
Description and Uses
tert-Butyl 5-bromoindoline-1-carboxylate is a brominated indoline derivative and a product of biocatalyzed halogenation of nucleobase analogs. It is used in the synthetic preparation of biologic ally active compounds such as selective human β3 adrenergic receptor agonists.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335-H410 |
| Precautionary statements | P261-P273-P301+P310-P305+P351+P338-P501 |
| target organs | Respiratory system |
| Hazard Codes | T,N |
| Risk Statements | 25-36/37/38-50/53 |
| Safety Statements | 26-45-60-61 |
| RIDADR | UN2811 - class 6.1 - PG 3 - EHS - Toxic solids, organic, n.o.s., HI: all |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| HS Code | 2933998090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








