BD2781645
(3-Bromopyridin-2-yl)methanol , 97% , 52378-64-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB46.40 | In Stock |
|
| 1g | RMB111.20 | In Stock |
|
| 5g | RMB516.00 | In Stock |
|
| 10g | RMB983.20 | In Stock |
|
| 25g | RMB1777.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 260.9±25.0 °C(Predicted) |
| Density | 1.668±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| pka | 12.75±0.10(Predicted) |
| Appearance | Off-white to brown Solid |
| InChI | InChI=1S/C6H6BrNO/c7-5-2-1-3-8-6(5)4-9/h1-3,9H,4H2 |
| InChIKey | FTTLCYCJDYIEFO-UHFFFAOYSA-N |
| SMILES | C1(CO)=NC=CC=C1Br |
Description and Uses
(3-bromopyridin-2-yl)methanol is commonly used as an intermediate in organic and pharmaceutical synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P260-P280 |
| RIDADR | UN2811 |
| HS Code | 2933399990 |
