BD2798745
2-Chloro-4-sulfamoylaniline , 97% , 53297-68-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB188.00 | In Stock |
|
| 250mg | RMB291.20 | In Stock |
|
| 1g | RMB752.00 | In Stock |
|
| 5g | RMB2724.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 161 °C |
| Boiling point: | 414.4±55.0 °C(Predicted) |
| Density | 1.558±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | solid |
| pka | 9.83±0.60(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C6H7ClN2O2S/c7-5-3-4(12(9,10)11)1-2-6(5)8/h1-3H,8H2,(H2,9,10,11) |
| InChIKey | LFIOFZKZCDMGFG-UHFFFAOYSA-N |
| SMILES | C1(S(N)(=O)=O)=CC=C(N)C(Cl)=C1 |
Description and Uses
2-Chloro-4-sulfamoylanilide is an organic compound commonly used as a synthetic intermediate, especially in the synthesis of pharmaceuticals, pesticides and dyes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
