BD2805745
N-(4-Chlorophenyl)-2-(2,6-dichlorophenyl)acetamide , 97% , 560075-65-2
CAS NO.:560075-65-2
Empirical Formula: C14H10Cl3NO
Molecular Weight: 314.59
MDL number: MFCD28138388
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB752.80 | In Stock |
|
| 250mg | RMB1126.40 | In Stock |
|
| 1g | RMB2813.60 | In Stock |
|
| 5g | RMB9836.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 215-217°C |
| Boiling point: | 496.8±45.0 °C(Predicted) |
| Density | 1.436±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | 13.00±0.70(Predicted) |
| form | Solid |
| color | White to Off-White |
| Major Application | pharmaceutical small molecule |
| InChI | InChI=1S/C14H10Cl3NO/c15-9-4-6-10(7-5-9)18-14(19)8-11-12(16)2-1-3-13(11)17/h1-7H,8H2,(H,18,19) |
| InChIKey | PZQRCZHTCCSTFP-UHFFFAOYSA-N |
| SMILES | C1(CC(NC2=CC=C(Cl)C=C2)=O)=C(Cl)C=CC=C1Cl |
Description and Uses
2,6-Dichloro-N-(4-chlorophenyl)-benzeneacetamide is an impurity of Diclofenac (D436450), a known nonsteroidal anti-inflammatory compound and cyclooxygenase (COX) inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |







