BD2830945
2-Cyanothioacetamide , 98% , 7357-70-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB66.40 | In Stock |
|
| 10g | RMB128.80 | In Stock |
|
| 25g | RMB233.60 | In Stock |
|
| 100g | RMB776.80 | In Stock |
|
| 500g | RMB3830.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118-120 °C (lit.) |
| Boiling point: | 264.0±42.0 °C(Predicted) |
| Density | 1.241 (estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Needles or Powder |
| pka | 12.18±0.29(Predicted) |
| color | Beige to brown |
| Water Solubility | Does not mix well with water. |
| Sensitive | Light Sensitive |
| BRN | 1699934 |
| InChI | InChI=1S/C3H4N2S/c4-2-1-3(5)6/h1H2,(H2,5,6) |
| InChIKey | BHPYMZQTCPRLNR-UHFFFAOYSA-N |
| SMILES | C(N)(=S)CC#N |
| CAS DataBase Reference | 7357-70-2(CAS DataBase Reference) |
Description and Uses
2-Cyanothioacetamide was used in the synthesis of 3,4-trans-4-aryl-3-(1-pyridinio)-1,2,3,4-tetrahydropyridine-6-thiolates and bis[6-(2-aryl)-2-thioxo-1,2-dihydropyridine-3-carbonitrile]. 2-Cyanothioacetamide is used as a building block for 2-pyridothiones. It can be used in agrochemical, pharmaceutical and dyestuff field etc,.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39-36/37/39-36 |
| RIDADR | UN 3439 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Light Sensitive |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29309090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |



