BD2836745
MonomethylAzelate , 97% , 2104-19-0
Synonym(s):
Azelaic acid monomethyl ester;Monomethyl azelate;mono-Methyl nonanedioate
CAS NO.:2104-19-0
Empirical Formula: C10H18O4
Molecular Weight: 202.25
MDL number: MFCD00004431
EINECS: 218-275-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB63.20 | In Stock |
|
| 5g | RMB232.00 | In Stock |
|
| 25g | RMB1004.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 22-24 °C (lit.) |
| Boiling point: | 159-160 °C/3 mmHg (lit.) |
| Density | 1.045 g/mL at 20 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Chloroform, DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.77±0.10(Predicted) |
| color | Colourless to Pale Yellow Oil |
| Water Solubility | Not miscible in water. |
| BRN | 1775786 |
| InChI | InChI=1S/C10H18O4/c1-14-10(13)8-6-4-2-3-5-7-9(11)12/h2-8H2,1H3,(H,11,12) |
| InChIKey | VVWPSAPZUZXYCM-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)CCCCCCCC(O)=O |
| CAS DataBase Reference | 2104-19-0(CAS DataBase Reference) |
Description and Uses
Methyl hydrogen azelate is used as pharmaceutical intermediates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29171390 |
| Storage Class | 11 - Combustible Solids |






