BD2849945
2,3-Dihydrobenzo[b][1,4]dioxin-6-amine , 96% , 22013-33-8
Synonym(s):
6-Amino-1,4-benzodioxan
CAS NO.:22013-33-8
Empirical Formula: C8H9NO2
Molecular Weight: 151.16
MDL number: MFCD00006824
EINECS: 244-718-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB38.40 | In Stock |
|
| 1g | RMB50.40 | In Stock |
|
| 5g | RMB197.60 | In Stock |
|
| 25g | RMB684.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 29-31 °C (lit.) |
| Boiling point: | 116-118°C 3mm |
| Density | 1.231 g/mL (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| form | Viscous Liquid After Melting |
| pka | 4.83±0.20(Predicted) |
| color | Brown to black |
| Specific Gravity | 1.231 |
| Water Solubility | insoluble |
| Sensitive | Light Sensitive |
| BRN | 6447 |
| InChI | InChI=1S/C8H9NO2/c9-6-1-2-7-8(5-6)11-4-3-10-7/h1-2,5H,3-4,9H2 |
| InChIKey | BZKOZYWGZKRTIB-UHFFFAOYSA-N |
| SMILES | O1C2=CC=C(N)C=C2OCC1 |
| CAS DataBase Reference | 22013-33-8(CAS DataBase Reference) |
Description and Uses
1,4-Benzodioxan-6-amine was used in the synthesis of N-(2-hydroxy-ethyl)-2,3-didehydroazapodophyllotoxins having anti-tumor activity and dioxanoacridinones.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38-38 |
| Safety Statements | 26-37/39-36/37-36 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29329995 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

![2,3-Dihydrobenzo[b][1,4]dioxin-6-amine](https://img.chemicalbook.com/CAS/GIF/22013-33-8.gif)



