BD2853245
(S)-3-((tert-Butoxycarbonyl)amino)-3-(4-chlorophenyl)propanoicacid , 95% , 479064-90-9
Synonym(s):
(S)-3-(Boc-amino)-3-(4-chlorophenyl)propionic acid;Boc-4-chloro-D -β-phenylalanine
CAS NO.：479064-90-9
Empirical Formula: C14H18ClNO4
Molecular Weight: 299.75
MDL number: MFCD03427922
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB251.20 | In Stock |
|
| 250mg | RMB500.80 | In Stock |
|
| 1g | RMB1269.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 453.9±40.0 °C(Predicted) |
| Density | 1.243±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 4.27±0.10(Predicted) |
| Appearance | White to off-white Solid |
| Major Application | peptide synthesis |
| InChI | 1S/C14H18ClNO4/c1-14(2,3)20-13(19)16-11(8-12(17)18)9-4-6-10(15)7-5-9/h4-7,11H,8H2,1-3H3,(H,16,19)(H,17,18)/t11-/m0/s1 |
| InChIKey | ZPXVKCUGZBGIBW-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(O)=O)c1ccc(Cl)cc1 |
| CAS DataBase Reference | 479064-90-9(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
