BD2853545
4-Aminonicotinonitrile , 96% , 15827-84-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB238.40 | In Stock |
|
| 250mg | RMB423.20 | In Stock |
|
| 1g | RMB1408.00 | In Stock |
|
| 5g | RMB5211.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 350.0±27.0 °C(Predicted) |
| Density | 1.23±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Sparingly), Methanol (Slightly) |
| form | Solid |
| pka | 5.73±0.12(Predicted) |
| color | White to Light Yellow |
| InChI | InChI=1S/C6H5N3/c7-3-5-4-9-2-1-6(5)8/h1-2,4H,(H2,8,9) |
| InChIKey | LCUHGVFLYAQKDO-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(N)=C1C#N |
Description and Uses
4-Amino-nicotinonitrile can be useful in the synthesis of 10-??(4-??Phenylpiperazine-??1-??carbonyl)??acridin-??9(10H)??-??ones and related compounds with potential antiproliferative activity and inhibition of tubulin polymerization.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P270-P304+P340+P312-P362-P332+P313-P261-P271-P280-P264-P301+P312+P330-P305+P351+P338+P310-P501-P302+P352 |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-39 |






