BD2855945
3-(Fluorosulfonyl)benzoicacid , 97% , 454-95-5
CAS NO.：454-95-5
Empirical Formula: C7H5FO4S
Molecular Weight: 204.18
MDL number: MFCD00007415
EINECS: 207-232-3
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB216.80 | In Stock |
|
| 250mg | RMB335.20 | In Stock |
|
| 1g | RMB838.40 | In Stock |
|
| 5g | RMB3052.80 | In Stock |
|
| 25g | RMB10380.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 147-153°C |
| Boiling point: | 358.8±25.0 °C(Predicted) |
| Density | 1.538±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 3.40±0.10(Predicted) |
| form | Solid |
| color | White to Pale Yellow |
| InChI | 1S/C7H5FO4S/c8-13(11,12)6-3-1-2-5(4-6)7(9)10/h1-4H,(H,9,10) |
| InChIKey | VWYMBWGOJRULOV-UHFFFAOYSA-N |
| SMILES | O=S(C1=CC(C(O)=O)=CC=C1)(F)=O |
Description and Uses
Sulfonyl fluoride motif can be used as a connector for the assembly of -SO2- linked small molecules with proteins or nucleic acids. This new click chemistry approach through sulfates is a complimentary approach to using amides and phosphate groups as linkers.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
