BD2864648
(S)-N-((R)-1-Phenylethyl)quinuclidin-3-aminedihydrochloride , 98+% , 128311-06-8
CAS NO.：128311-06-8
Empirical Formula: C15H24Cl2N2
Molecular Weight: 303.27
MDL number: MFCD01321399
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB1037.60 | In Stock |
|
| 250mg | RMB1758.40 | In Stock |
|
| 1g | RMB3839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 285 °C (dec.)(lit.) |
| storage temp. | Sealed in dry,Room Temperature |
| Appearance | White to off-white Solid |
| optical activity | [α]22/D 2°, c = 2 in chloroform |
| InChI | 1S/C15H22N2.2ClH/c1-12(13-5-3-2-4-6-13)16-15-11-17-9-7-14(15)8-10-17;;/h2-6,12,14-16H,7-11H2,1H3;2*1H/t12-,15-;;/m1../s1 |
| InChIKey | BABMCKVVGDIUCA-DGPOFWGLSA-N |
| SMILES | Cl.Cl.C[C@@H](N[C@@H]1CN2CC[C@H]1CC2)c3ccccc3 |
Description and Uses
Palonsetron intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
