BD2887148
2-Methyl-4-(trifluoromethyl)aniline , 98% , 67169-22-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB80.00 | In Stock |
|
| 1g | RMB231.20 | In Stock |
|
| 5g | RMB1019.20 | In Stock |
|
| 10g | RMB1792.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 20-25° |
| Boiling point: | 202.8±40.0 °C(Predicted) |
| Density | 1.237±0.06 g/cm3(Predicted) |
| Flash point: | 84° |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 2.62±0.10(Predicted) |
| form | Low Melting Solid |
| color | White |
| InChI | InChI=1S/C8H8F3N/c1-5-4-6(8(9,10)11)2-3-7(5)12/h2-4H,12H2,1H3 |
| InChIKey | PAXQXJDYVORMOO-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(C(F)(F)F)C=C1C |
Description and Uses
2-Methyl-4-(trifluoromethyl) aniline has a wide application in pharmaceutical chemistry and organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H312-H315-H319-H331-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | T |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 2810 |
| HazardClass | 6.1 |
| HS Code | 2921420090 |







