BD2891245
rel-(1R,5S,6r)-tert-Butyl6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate , 95% , 419572-18-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB155.20 | In Stock |
|
| 250mg | RMB258.40 | In Stock |
|
| 1g | RMB691.20 | In Stock |
|
| 5g | RMB2642.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 308℃ |
| Density | 1.157 |
| Flash point: | 140℃ |
| storage temp. | 2-8°C |
| pka | 14.94±0.10(Predicted) |
| Appearance | Colorless to off-white Viscous Liquid |
| InChI | InChI=1S/C11H19NO3/c1-11(2,3)15-10(14)12-4-7-8(5-12)9(7)6-13/h7-9,13H,4-6H2,1-3H3 |
| InChIKey | JVIDPFGQYMFQDZ-UHFFFAOYSA-N |
| SMILES | C12C(C1CO)CN(C(OC(C)(C)C)=O)C2 |
Description and Uses
exo-3-Boc-3-azabicyclo[3.1.0]hexane-6-methanol is a useful reactant in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HazardClass | IRRITANT |

![rel-(1R,5S,6r)-tert-Butyl6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate](https://img.chemicalbook.com/CAS2/GIF/419572-18-2.gif)


![tert-Butyl(3aR,5s,6aS)-rel-5-(Hydroxymethyl)hexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate](https://img.chemicalbook.com/CAS/20200119/GIF/2220998-56-9.gif)

![Tert-butyl(3aR,6aS)-5-hydroxy-5-methylhexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate](https://img.chemicalbook.com/CAS/20180531/GIF/1627747-31-2.gif)
![(1R,4S)-tert-Butyl3-oxo-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate](https://img.chemicalbook.com/CAS/GIF/151792-53-9.gif)