BD2891748
(2S)-2-Amino-4-(S-methylsulfonimidoyl)butanoicacid , 98% , 15985-39-4
Synonym(s):
L -S-(3-Amino-3-carboxypropyl)-S-methylsulfoximine
CAS NO.:15985-39-4
Empirical Formula: C5H12N2O3S
Molecular Weight: 180.23
MDL number: MFCD00002621
EINECS: 629-483-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB416.80 | In Stock |
|
| 250mg | RMB629.60 | In Stock |
|
| 1g | RMB1587.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >210 °C (dec.)(lit.) |
| Boiling point: | 352.2±52.0 °C(Predicted) |
| Density | 1.215 (estimate) |
| refractive index | 1.6430 (estimate) |
| storage temp. | 20-25°C |
| solubility | Aqueous Base (Slightly), Formic Acid (Slightly), Water (Sparingly, Sonicated) |
| form | Crystalline Powder |
| color | White or almost white |
| biological source | synthetic |
| optical activity | [α]20/D +10.8 to +14.0°, c = 1 in H2O |
| BRN | 6175446 |
| Stability: | Temperature Sensitive |
| InChI | InChI=1S/C5H12N2O3S/c1-11(7,10)3-2-4(6)5(8)9/h4,7H,2-3,6H2,1H3,(H,8,9)/t4-,11/m0/s1 |
| InChIKey | SXTAYKAGBXMACB-DPVSGNNYSA-N |
| SMILES | C(O)(=O)[C@@H](N)CCS(C)(=O)=N |
| CAS DataBase Reference | 15985-39-4(CAS DataBase Reference) |
Description and Uses
L-Methionine sulfoximine has been used as a potent inhibitor of glutamine synthetase (GS) activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






