BD2897845
XanthinolNicotinate , 98% , 437-74-1
CAS NO.:437-74-1
Empirical Formula: C19H26N6O6
Molecular Weight: 434.45
MDL number: MFCD00058342
EINECS: 207-115-7
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB104.80 | In Stock |
|
| 10mg | RMB141.60 | In Stock |
|
| 25mg | RMB190.40 | In Stock |
|
| 50mg | RMB256.80 | In Stock |
|
| 100mg | RMB346.40 | In Stock |
|
| 250mg | RMB467.20 | In Stock |
|
| 1g | RMB630.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 180° |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Water (Slightly) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Water: 250 mg/mL (575.44 mM) |
| InChI | InChI=1S/C13H21N5O4.C6H5NO2/c1-15(4-5-19)6-9(20)7-18-8-14-11-10(18)12(21)17(3)13(22)16(11)2;8-6(9)5-2-1-3-7-4-5/h8-9,19-20H,4-7H2,1-3H3;1-4H,(H,8,9) |
| InChIKey | GEPMAHVDJHFBJI-UHFFFAOYSA-N |
| SMILES | C12C(=O)N(C(=O)N(C)C=1N=CN2CC(O)CN(C)CCO)C.C1(C(=O)O)C=NC=CC=1 |
| CAS DataBase Reference | 437-74-1(CAS DataBase Reference) |
Description and Uses
Sedative, Hypnotic
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P280-P305+P351+P338 |
| WGK Germany | 2 |
| RTECS | QT1500000 |
| HazardClass | IRRITANT |






