BD2913745
Methyl2-methyl-3-furoate , 95% , 6141-58-8
CAS NO.:6141-58-8
Empirical Formula: C7H8O3
Molecular Weight: 140.14
MDL number: MFCD00003249
EINECS: 228-132-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB57.60 | In Stock |
|
| 5g | RMB196.80 | In Stock |
|
| 25g | RMB588.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 75 °C20 mm Hg(lit.) |
| Density | 1.116 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 147 °F |
| storage temp. | 2-8°C |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| BRN | 1342040 |
| InChI | InChI=1S/C7H8O3/c1-5-6(3-4-10-5)7(8)9-2/h3-4H,1-2H3 |
| InChIKey | UVRRIABXNIGUJZ-UHFFFAOYSA-N |
| SMILES | O1C=CC(C(OC)=O)=C1C |
| LogP | 1.730 (est) |
| CAS DataBase Reference | 6141-58-8(CAS DataBase Reference) |
Description and Uses
Methyl 2-methyl-3-furoate is a useful building block used in a variety of synthetic applications, such as the nickel-catalyzed amide bond formation from methyl esters, and gold-catalyzed arylation by arylsilanes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210e-P280a-P370+P378a-P403+P235-P501a |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29321900 |
| Storage Class | 10 - Combustible liquids |







