BD2929545
3-Boc-Amino-2,6-dioxopiperidine , 98% , 31140-42-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB60.00 | In Stock |
|
| 5g | RMB184.00 | In Stock |
|
| 10g | RMB313.60 | In Stock |
|
| 25g | RMB552.00 | In Stock |
|
| 100g | RMB1823.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 193.7-194.4 °C |
| Boiling point: | 423.0±34.0 °C(Predicted) |
| Density | 1.20 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly, Heated), DMF (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 10.78±0.20(Predicted) |
| color | White |
| InChI | 1S/C10H16N2O4/c1-10(2,3)16-9(15)11-6-4-5-7(13)12-8(6)14/h6H,4-5H2,1-3H3,(H,11,15)(H,12,13,14) |
| InChIKey | TUGRLMXVKASPTN-UHFFFAOYSA-N |
| SMILES | O=C(C(CC1)NC(OC(C)(C)C)=O)NC1=O |
Description and Uses
tert-Butyl (2,6-Dioxopiperidin-3-yl)carbamate is an intermediate in the synthesis of Thalidomide-d4 (T338852), a labelled Thalidomide, which inhibits FGF-induced angiogenesis. Inhibits replication of human immunodeficiency virus type 1. Teratogenic sedative.
