BD2929948
Bis(2-chloroethyl)carbamicchloride , 97% , 2998-56-3
CAS NO.：2998-56-3
Empirical Formula: C5H8Cl3NO
Molecular Weight: 204.48
MDL number: MFCD00144974
EINECS: 221-075-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB120.80 | In Stock |
|
| 25g | RMB424.80 | In Stock |
|
| 100g | RMB1415.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 101-103 °C |
| Boiling point: | 125°C 3mm |
| Density | 1,4 g/cm3 |
| refractive index | 1.5060-1.5100 |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | -2.30±0.70(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C5H8Cl3NO/c6-1-3-9(4-2-7)5(8)10/h1-4H2 |
| InChIKey | JAHXVUPWHXMPLG-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)N(CCCl)CCCl |
Safety
| Symbol(GHS) |   GHS05,GHS08 |
| Signal word | Danger |
| Hazard statements | H314-H341 |
| Precautionary statements | P201-P202-P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P308+P313-P405-P501 |
| Hazard Codes | T |
| Risk Statements | 34-43-25 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 3265 |
| RTECS | FD2200000 |
| HS Code | 2929.90.5090 |
| HazardClass | 8 |
| PackingGroup | II |
| Toxicity | mouse,LC,inhalation,> 1540mg/m3/10 (1540mg/m3),National Defense Research Committee, Office of Scientific Research and Development, Progress Report.Vol. NDCrc-132, Pg. Nov, 1942. |
