BD2932148
4,4'-(3,3,5-Trimethylcyclohexane-1,1-diyl)diphenol , 98% , 129188-99-4
Synonym(s):
1,1-Bis(4-hydroxyphenyl)-3,3,5-trimethylcyclohexane;4,4′-(3,3,5-Trimethylcyclohexylidene)bisphenol;4,4′-(3,3,5-Trimethylcyclohexylidene)diphenol;BISP-TMC;BPTMC
CAS NO.:129188-99-4
Empirical Formula: C21H26O2
Molecular Weight: 310.43
MDL number:
EINECS: 603-320-4
| Pack Size | Price | Stock | Quantity |
| 100g | RMB3744.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 204-207°C |
| Boiling point: | 450.8±38.0 °C(Predicted) |
| Density | 1.075±0.06 g/cm3(Predicted) |
| storage temp. | Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 9.91±0.30(Predicted) |
| form | Solid |
| color | White to Off-White |
| BRN | 9785841 |
| InChI | InChI=1S/C21H26O2/c1-15-12-20(2,3)14-21(13-15,16-4-8-18(22)9-5-16)17-6-10-19(23)11-7-17/h4-11,15,22-23H,12-14H2,1-3H3 |
| InChIKey | UMPGNGRIGSEMTC-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(O)C=C2)(C2=CC=C(O)C=C2)CC(C)CC(C)(C)C1 |
| EPA Substance Registry System | Phenol, 4,4'-(3,3,5-trimethylcyclohexylidene)bis- (129188-99-4) |
Description and Uses
Bisphenol TMC, also known as 2,2-bis-(4-hydroxy phenyl) butane, is a very important organic chemistry raw material, they are as macromolecular material intermediate, are applied in the fields such as synthetic epoxy resin, cyanate, polycarbonate, polyarylester and resol widely.
Bisphenol TMC(1,1-Bis(4-hydroxyphenyl)-3,3,5-trimethylcyclohexane) is a bisphenol derivative used in the preparation of polycarbonate, polyester and epoxy resins.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |





