BD2936745
2,5-Dioxopyrrolidin-1-yl3-(pyridin-2-yldisulfanyl)propanoate , 97% , 68181-17-9
Synonym(s):
N-Succinimidyl 3-(2-pyridyldithio)propionate;SPDP
CAS NO.:68181-17-9
Empirical Formula: C12H12N2O4S2
Molecular Weight: 312.36
MDL number: MFCD00009636
EINECS: 269-034-3
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB146.40 | In Stock |
|
| 250mg | RMB219.20 | In Stock |
|
| 1g | RMB566.40 | In Stock |
|
| 5g | RMB1998.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 84-86 °C(lit.) |
| Boiling point: | 465.9±55.0 °C(Predicted) |
| Density | 1.48±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | acetone: 50 mg/mL |
| form | powder |
| pka | 1.76±0.19(Predicted) |
| color | White to Light Yellow |
| BRN | 1548137 |
| Stability: | Hygroscopic, Moisture Sensitive |
| InChI | InChI=1S/C12H12N2O4S2/c15-10-4-5-11(16)14(10)18-12(17)6-8-19-20-9-3-1-2-7-13-9/h1-3,7H,4-6,8H2 |
| InChIKey | JWDFQMWEFLOOED-UHFFFAOYSA-N |
| SMILES | C(ON1C(=O)CCC1=O)(=O)CCSSC1=NC=CC=C1 |
| CAS DataBase Reference | 68181-17-9(CAS DataBase Reference) |
Description and Uses
SPDP NHS ester is a heterobiofunctional crosslinker which can react with amine and sulfhydryl groups. SPDP NHS esters are membrane permeable therefore allowing them to funtion inside of cells.
Important crosslinking reagent for the preparation of protein-protein and peptide-protein conjugates linked by disulfide bonds.







