BD2947445
Benzofuran-5-amine , 97% , 58546-89-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB147.20 | In Stock |
|
| 250mg | RMB214.40 | In Stock |
|
| 1g | RMB671.20 | In Stock |
|
| 5g | RMB2768.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 259.8±13.0 °C(Predicted) |
| Density | 1.225±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 3.87±0.10(Predicted) |
| form | liquid |
| color | Orange |
| InChI | InChI=1S/C8H7NO/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5H,9H2 |
| InChIKey | GMOLCSICTCPZCU-UHFFFAOYSA-N |
| SMILES | O1C2=CC=C(N)C=C2C=C1 |
Description and Uses
5-Benzofuranamine acts as a reagent in the synthesis of substituted pyrimidines as multi-targeted receptor tyrosine kinase and microtubule inhibitors as potential antitumor agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Note | Harmful |
| HS Code | 2932990090 |
