BD2948148
Potassium1H-indol-3-ylsulfate , 98% , 2642-37-7
Synonym(s):
Potassium 3-indoxyl sulfate;Urinary indican
CAS NO.:2642-37-7
Empirical Formula: C8H8KNO4S
Molecular Weight: 253.31
MDL number: MFCD00037931
EINECS: 220-145-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB190.40 | In Stock |
|
| 250mg | RMB323.20 | In Stock |
|
| 1g | RMB840.00 | In Stock |
|
| 5g | RMB2939.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165 °C (dec.)(lit.) |
| storage temp. | -20°C |
| solubility | DMSO (Sparingly), Methanol (Slightly) |
| form | Solid |
| color | light yellow |
| Sensitive | Light Sensitive |
| BRN | 3921324 |
| Stability: | Hygroscopic |
| InChI | 1S/C8H7NO4S.K/c10-14(11,12)13-8-5-9-7-4-2-1-3-6(7)8;/h1-5,9H,(H,10,11,12);/q;+1/p-1 |
| InChIKey | MDAWATNFDJIBBD-UHFFFAOYSA-M |
| SMILES | [K+].[O-]S(=O)(=O)Oc1c[nH]c2ccccc12 |
| CAS DataBase Reference | 2642-37-7(CAS DataBase Reference) |
Description and Uses
An uremic toxin that acts as a potent endogenous agonist for the human aryl hydrocarbon receptor (AHR). Studies suggest that it is a sensitive and early biomarker of nephrotoxicity.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H227 |
| Precautionary statements | P501-P210-P264-P280-P370+P378-P303+P361+P353-P301+P330+P331-P363-P304+P340+P310-P305+P351+P338+P310-P403+P235-P405 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | NM3200000 |
| F | 8-10-23 |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |



