BD2957145
2,2'-(Piperazine-1,4-diyl)diethanamine , 95% , 6531-38-0
CAS NO.:6531-38-0
Empirical Formula: C8H20N4
Molecular Weight: 172.27
MDL number: MFCD00720062
EINECS: 229-428-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB384.80 | In Stock |
|
| 250mg | RMB715.20 | In Stock |
|
| 1g | RMB1788.80 | In Stock |
|
| 5g | RMB5976.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 40 °C |
| Boiling point: | 130 °C(Press: 12 Torr) |
| Density | 0.9675 g/cm3(Temp: 25 °C) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | Solid |
| pka | 10.41±0.10(Predicted) |
| InChI | InChI=1S/C8H20N4/c9-1-3-11-5-7-12(4-2-10)8-6-11/h1-10H2 |
| InChIKey | PAOXFRSJRCGJLV-UHFFFAOYSA-N |
| SMILES | N1(CCN)CCN(CCN)CC1 |
| NIST Chemistry Reference | N,N'-Di-(2-aminoethyl)piperazine(6531-38-0) |
| EPA Substance Registry System | 1,4-Piperazinediethanamine (6531-38-0) |
Description and Uses
1,4-Piperazinediethylamine-d8 is the isotope labelled analog of 1,4-Piperazinediethylamine (P480090); a reagent in the synthesis of bis-thiazolone derivatives as micromolar CDC25 phosphatase inhibitors. Also used as a reagent in the synthesis of novel bisnaphthalimides as new DNA topoisomerase II inhibitors.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| RIDADR | 1760 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |




