BD2965545
3-Methyl-2,4-pentanedione , 97% , 815-57-6
CAS NO.：815-57-6
Empirical Formula: C6H10O2
Molecular Weight: 114.14
MDL number: MFCD00008762
EINECS: 212-420-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB172.00 | In Stock |
|
| 10g | RMB296.00 | In Stock |
|
| 25g | RMB415.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -7.75°C (estimate) |
| Boiling point: | 172-174 °C(lit.) |
| Density | 0.981 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 134 °F |
| storage temp. | Inert atmosphere,2-8°C |
| pka | pK1:10.87 (25°C) |
| form | clear liquid |
| color | Light yellow to Yellow to Green |
| Water Solubility | Soluble in water. |
| BRN | 635909 |
| InChI | InChI=1S/C6H10O2/c1-4(5(2)7)6(3)8/h4H,1-3H3 |
| InChIKey | GSOHKPVFCOWKPU-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C)C(=O)C |
| LogP | 0.623 (est) |
| CAS DataBase Reference | 815-57-6(CAS DataBase Reference) |
Description and Uses
3-Methyl-2,4-pentanedione involves in asymmetric substitution of 1,3-diphenyl-2-propenyl acetate catalyzed by amphiphilic resin-supported monodentate phosphine ligands can occur.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P233-P240-P241-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 1224 3/PG 3 |
| WGK Germany | 3 |
| HS Code | 2914.19.0000 |
| HazardClass | 3 |
| PackingGroup | III |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
