BD2982245
Trimethylsilyl2-((trimethylsilyl)oxy)acetate , 97% , 33581-77-0
CAS NO.:33581-77-0
Empirical Formula: C8H20O3Si2
Molecular Weight: 220.41
MDL number: MFCD00009840
EINECS: 251-580-9
| Pack Size | Price | Stock | Quantity |
| 5g | RMB71.20 | In Stock |
|
| 25g | RMB253.60 | In Stock |
|
| 100g | RMB844.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 82-83 °C15 mm Hg |
| Density | 0.903 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 110 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| Specific Gravity | 0.918 |
| Appearance | Colorless to light yellow Liquid |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 2045011 |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | 1S/C8H20O3Si2/c1-12(2,3)10-7-8(9)11-13(4,5)6/h7H2,1-6H3 |
| InChIKey | MAEQOWMWOCEXKP-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OCC(=O)O[Si](C)(C)C |
Description and Uses
Trimethylsilyl trimethylsiloxyacetate has been used in the synthesis of zirconium(IV) carboxylato complexes [LOEtZr(OCOCH2OH)(O2CCH2O)]2.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 3272 3/PG 3 |
| WGK Germany | 2 |
| F | 21 |
| TSCA | No |
| HazardClass | 3.2 |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








