BD2982345
trans-4-(4-Chlorophenyl)cyclohexanecarboxylicacid , 98% , 49708-81-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB36.00 | In Stock |
|
| 10g | RMB52.00 | In Stock |
|
| 25g | RMB84.00 | In Stock |
|
| 100g | RMB308.00 | In Stock |
|
| 500g | RMB1166.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 252-254 °C |
| Boiling point: | 387.1±42.0 °C(Predicted) |
| Density | 1.225±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly, Sonicated), DMSO (Slightly), Methanol (Slightly, Sonicated) |
| form | Solid |
| pka | 4.80±0.10(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C13H15ClO2/c14-12-7-5-10(6-8-12)9-1-3-11(4-2-9)13(15)16/h5-9,11H,1-4H2,(H,15,16)/t9-,11- |
| InChIKey | NXXDIEYTMQYWJU-HOMQSWHASA-N |
| SMILES | [C@@H]1(C(O)=O)CC[C@@H](C2=CC=C(Cl)C=C2)CC1 |
Description and Uses
trans-4-(4-Chlorophenyl)cyclohexanecarboxylic Acid is an impurity of Atovaquone (A793500), which is a hydroxynaphthoquinone derivative that inhibits mitochondrial electron transport and possess antipneumocystic activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HS Code | 2925290090 |






