BD3001845
Thieno[3,2-b]thiophene-2-carbonitrile , 95% , 40985-58-8
CAS NO.:40985-58-8
Empirical Formula: C7H3NS2
Molecular Weight: 165.24
MDL number: MFCD08059461
EINECS: 808-215-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB109.60 | In Stock |
|
| 250mg | RMB196.00 | In Stock |
|
| 1g | RMB770.40 | In Stock |
|
| 5g | RMB3624.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 48.0 to 52.0 °C |
| Boiling point: | 318.8±22.0 °C(Predicted) |
| Density | 1.44±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| InChI | InChI=1S/C7H3NS2/c8-4-5-3-7-6(10-5)1-2-9-7/h1-3H |
| InChIKey | UPRBPGCXCNBTQH-UHFFFAOYSA-N |
| SMILES | C12C=CSC=1C=C(C#N)S2 |
| color | Off-white powder/crystals |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| HS Code | 2934.99.4400 |

![Thieno[3,2-b]thiophene-2-carbonitrile](https://img.chemicalbook.com/CAS/GIF/40985-58-8.gif)

![Thieno[3,2-b]thiophene](https://img.chemicalbook.com/CAS/GIF/251-41-2.gif)
![Thieno[2,3-b]pyridine-2-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/59944-76-2.gif)
![Thiazolo[5,4-b]pyridin-2-amine](https://img.chemicalbook.com/CAS/GIF/31784-70-0.gif)
![Thieno[2,3-b]pyrazine](https://img.chemicalbook.com/CAS/GIF/56088-28-9.gif)