BD3019145
3,5-Di(pyridin-4-yl)-4H-1,2,4-triazol-4-amine , 97% , 38634-05-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB202.40 | In Stock |
|
| 250mg | RMB246.40 | In Stock |
|
| 1g | RMB526.40 | In Stock |
|
| 5g | RMB2132.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 335-340 °C (decomp) |
| Boiling point: | 555.6±60.0 °C(Predicted) |
| Density | 1.42±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly), Pyridine (Slightly, Heated) |
| form | Solid |
| pka | 2.22±0.10(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C12H10N6/c13-18-11(9-1-5-14-6-2-9)16-17-12(18)10-3-7-15-8-4-10/h1-8H,13H2 |
| InChIKey | HBXLKHXFCBAVDO-UHFFFAOYSA-N |
| SMILES | N1=C(C2C=CN=CC=2)N(N)C(C2C=CN=CC=2)=N1 |
Description and Uses
4-Amino-3,5-bis(4-pyridyl)-1,2,4-triazole can be used to preparecadmium aminoisophthalate pyridinyltriazolamine metal-organic frameworks for detection applications. It has also been utilized to synthesizea linear trinuclear Cu(II) complex with magnetic properties.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |






