PRODUCT Properties
| Melting point: | 223-226 °C (lit.) |
| Boiling point: | 352.3±37.0 °C(Predicted) |
| Density | 2.894 |
| refractive index | 1.5000 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.43±0.33(Predicted) |
| color | Needles from EtOH |
| Water Solubility | Insoluble |
| BRN | 1876757 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. |
| InChI | 1S/C6HBr5O/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |
| InChIKey | SVHOVVJFOWGYJO-UHFFFAOYSA-N |
| SMILES | Oc1c(Br)c(Br)c(Br)c(Br)c1Br |
| CAS DataBase Reference | 608-71-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Pentabromophenol(608-71-9) |
| EPA Substance Registry System | Pentabromophenol (608-71-9) |
Description and Uses
Flame retardant, molluscicide, and chemical intermediate.
Safety
| Symbol(GHS) |   GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H315-H319-H335-H400 |
| Precautionary statements | P261-P273-P280-P301+P310-P305+P351+P338-P311 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,N |
| Risk Statements | 23/24/25-36/37/38-50/53-50 |
| Safety Statements | 26-36/37-45-60-61 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | SM6125000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29081990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 608-71-9(Hazardous Substances Data) |
| Toxicity | LDLo ipr-mus: 250 mg/kg CBCCT* 5,288,53 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
