BD3057145
2,3-Dihydroxyterephthalicacid , 97% , 19829-72-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB37.60 | In Stock |
|
| 1g | RMB81.60 | In Stock |
|
| 5g | RMB311.20 | In Stock |
|
| 25g | RMB1412.00 | In Stock |
|
| 100g | RMB4411.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 309-310℃ (ethanol ethyl ether ) |
| Boiling point: | 456.5±45.0 °C(Predicted) |
| Density | 1.779±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 2.23±0.13(Predicted) |
| Appearance | Light brown to gray Solid |
| InChI | InChI=1S/C8H6O6/c9-5-3(7(11)12)1-2-4(6(5)10)8(13)14/h1-2,9-10H,(H,11,12)(H,13,14) |
| InChIKey | OHLSHRJUBRUKAN-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=CC=C(C(O)=O)C(O)=C1O |
Description and Uses
2,3-Dihydroxyterephthalic acid is used as a ligand in the synthesis of MOF materials: polyester monomer UiO-66-Cat(M)M=Fe,Ti..
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H335-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |





