BD3090657
7-(Diethylamino)-4-(trifluoromethyl)-2H-chromen-2-one , 97% , 41934-47-8
CAS NO.：41934-47-8
Empirical Formula: C14H14F3NO2
Molecular Weight: 285.26
MDL number: MFCD00057313
EINECS: 255-593-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB234.40 | In Stock |
|
| 1g | RMB632.00 | In Stock |
|
| 5g | RMB2210.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 80-81 °C |
| Boiling point: | 352.7±42.0 °C(Predicted) |
| Density | 1.405 g/cm3 |
| storage temp. | 2-8°C, protect from light |
| pka | 2.74±0.20(Predicted) |
| form | powder to crystal |
| color | Yellow to Brown to Dark green |
| λmax | 411nm(H2O)(lit.) |
| InChI | InChI=1S/C14H14F3NO2/c1-3-18(4-2)9-5-6-10-11(14(15,16)17)8-13(19)20-12(10)7-9/h5-8H,3-4H2,1-2H3 |
| InChIKey | UIMOXRDVWDLOHW-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=CC(N(CC)CC)=CC=C2C(C(F)(F)F)=C1 |
| EPA Substance Registry System | 2H-1-Benzopyran-2-one, 7-(diethylamino)-4-(trifluoromethyl)- (41934-47-8) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| WGK Germany | 3 |
| HS Code | 2916399090 |
