BD3114848
6,7-Dihydroxy-3-(4-hydroxyphenyl)-4H-chromen-4-one , 95+% , 17817-31-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB2053.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >280℃ |
| Boiling point: | 587.1±50.0 °C(Predicted) |
| Density | 1.548±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Dimethylformamide |
| form | powder to crystal |
| pka | 6.85±0.20(Predicted) |
| color | Light yellow to Brown to Dark green |
| biological source | synthetic |
| Major Application | clinical research general analytical life science and biopharma metabolomics |
| InChI | InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)11-7-20-14-6-13(18)12(17)5-10(14)15(11)19/h1-7,16-18H |
| InChIKey | GYLUFQJZYAJQDI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=COC3=CC(=C(C=C3C2=O)O)O)O |
| LogP | 2.170 (est) |
| CAS DataBase Reference | 17817-31-1(CAS DataBase Reference) |
Description and Uses
4'',?6,?7-?Trihydroxyisoflavone is an isoflavone modulator of adenosine-monophosphate-activated protein kinase.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS05,GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H330-H302-H314-H370-H372-H373-H341-H350-H411-H290 |
| Precautionary statements | P501-P273-P260-P270-P202-P234-P201-P271-P264-P280-P284-P390-P391-P308+P311-P303+P361+P353-P301+P330+P331-P363-P301+P312+P330-P304+P340+P310-P305+P351+P338+P310-P403+P233-P406-P405 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 2914.69.9000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 |







