Hydroxyflutamide , 98% , 52806-53-8
Synonym(s):
2-Hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]-propanamide;2-Hydroxyflutamide;a,a,a-Trifluoro-2-methyl-4′-nitro-m-lactotoluidide;Hydroxyniphtholide;Sch 16423
CAS NO.:52806-53-8
Empirical Formula: C11H11F3N2O4
Molecular Weight: 292.21
MDL number: MFCD00563126
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB65.60 | In Stock |
|
| 250mg | RMB97.60 | In Stock |
|
| 1g | RMB232.00 | In Stock |
|
| 5g | RMB817.60 | In Stock |
|
| 10g | RMB1391.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 125-130°C |
| Boiling point: | 443.8±45.0 °C(Predicted) |
| Density | 1.472 |
| storage temp. | room temp |
| solubility | DMSO: >10mg/mL |
| pka | 12.87±0.70(Predicted) |
| form | powder |
| color | white to tan |
| InChI | 1S/C11H11F3N2O4/c1-10(2,18)9(17)15-6-3-4-8(16(19)20)7(5-6)11(12,13)14/h3-5,18H,1-2H3,(H,15,17) |
| InChIKey | YPQLFJODEKMJEF-UHFFFAOYSA-N |
| SMILES | CC(C)(O)C(=O)Nc1ccc(c(c1)C(F)(F)F)[N+]([O-])=O |
Description and Uses
2-
HYDROXYFLUTAMIDE is used non-steroidal antagonist Flutamide. Shown to be an antianhydrogen.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| RTECS | TX1466250 |
| HS Code | 2924297099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







