BD3123345
N-Benzyl-1-(4-methoxyphenyl)propan-2-amine , 95% , 43229-65-8
CAS NO.:43229-65-8
Empirical Formula: C17H21NO
Molecular Weight: 255.35
MDL number: MFCD00025847
EINECS: 256-155-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB40.80 | In Stock |
|
| 25g | RMB139.20 | In Stock |
|
| 100g | RMB457.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 377.8±22.0 °C(Predicted) |
| Density | 1.024±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Miscible with methanol, Methylene chloride. Immiscible with water |
| form | Oil |
| pka | 9.54±0.19(Predicted) |
| color | Pale yellow to yellow liquid |
| InChI | InChI=1S/C17H21NO/c1-14(18-13-16-6-4-3-5-7-16)12-15-8-10-17(19-2)11-9-15/h3-11,14,18H,12-13H2,1-2H3 |
| InChIKey | CVGPWMGXKOKNFD-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(OC)C=C1)C(NCC1=CC=CC=C1)C |
| LogP | 4.8 |
| CAS DataBase Reference | 43229-65-8(CAS DataBase Reference) |
Description and Uses
1-(4-Methoxyphenyl)-2-(benzylamino)propane is an intermediate in the synthesis of Formoterol Fumarate (F693401).
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H411 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| REACH Registrations | Active |






