BD3130248
(R)-2-((1-Phenylethyl)carbamoyl)benzoicacid , 98% , 21752-35-2
Synonym(s):
(R)-(+)-N-(α-Methylbenzyl)phthalamic acid;(R)-(+)-N-(α-Methylbenzyl)phthalic acid monoamide
CAS NO.:21752-35-2
Empirical Formula: C16H15NO3
Molecular Weight: 269.3
MDL number: MFCD00063050
EINECS: 244-570-0
| Pack Size | Price | Stock | Quantity |
| 25g | RMB4081.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 128-130 °C |
| alpha | +46°(24℃, c=2, C2H5OH) |
| Boiling point: | 500.3±43.0 °C(Predicted) |
| Density | 1.222±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.48±0.36(Predicted) |
| color | White to Almost white |
| optical activity | [α]24/D +46°, c = 2 in ethanol |
| BRN | 5793588 |
| InChI | 1S/C16H15NO3/c1-11(12-7-3-2-4-8-12)17-15(18)13-9-5-6-10-14(13)16(19)20/h2-11H,1H3,(H,17,18)(H,19,20)/t11-/m1/s1 |
| InChIKey | VCFKXWGKKDZMPO-LLVKDONJSA-N |
| SMILES | C[C@@H](NC(=O)c1ccccc1C(O)=O)c2ccccc2 |
Description and Uses
Acid for the resolution of amines.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H335-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2924.29.7790 |
| Storage Class | 11 - Combustible Solids |



![(R)-(?)-N-[1-(1-Naphthyl)ethyl]phthalamic acid](https://img.chemicalbook.com/CAS/GIF/163438-05-9.gif)



