BD3139045
(2R,3S,4R,5R)-2,3,4,5-Tetrahydroxy-6-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)hexanal , 97% , 499-40-1
Synonym(s):
6-O-α-D -Glucopyranosyl-D -glucose;Isomaltose
CAS NO.:499-40-1
Empirical Formula: C12H22O11
Molecular Weight: 342.3
MDL number: MFCD00065373
EINECS: 207-879-1
| Pack Size | Price | Stock | Quantity |
| 10g | RMB140.00 | In Stock |
|
| 25g | RMB265.60 | In Stock |
|
| 100g | RMB797.60 | In Stock |
|
| 500g | RMB2951.20 | In Stock |
|
| 1000g | RMB5017.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 155-160°C |
| Boiling point: | 774.5±60.0 °C(Predicted) |
| Density | 1.68±0.1 g/cm3(Predicted) |
| refractive index | 113 ° (C=0.7, H2O) |
| storage temp. | -20°C |
| solubility | DMF: 10 mg/ml; DMSO: 5 mg/ml; PBS (pH 7.2): 5 mg/ml |
| form | lyophilized powder |
| pka | 12.45±0.20(Predicted) |
| color | White |
| optical activity | [α]/D 107.0±4.0°, 24 hr, c = 1 in H2O |
| Water Solubility | almost transparency |
| BRN | 93355 |
| Stability: | Very Hygroscopic |
| InChI | 1S/C12H22O11/c13-1-3-5(14)8(17)10(19)12(23-3)21-2-4-6(15)7(16)9(18)11(20)22-4/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11?,12+/m1/s1 |
| InChIKey | DLRVVLDZNNYCBX-RTPHMHGBSA-N |
| SMILES | OC[C@H]1O[C@H](OC[C@H]2OC(O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| LogP | -4.606 (est) |
Description and Uses
One of the main product of transformation of maltose into prebiotic isomaltooligosaccharides by novel α-glucosidase from Xantophyllomyces dendrorhous.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319 |
| Precautionary statements | P501-P261-P270-P271-P264-P280-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330-P302+P352+P312-P304+P340+P312 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |





